C18H24N2O4 — CID 144738571
tert-butyl (3S)-3-[(2-formylbenzoyl)-methylamino]pyrrolidine-1-carboxylate (PubChem CID 144738571) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is tert-butyl (3S)-3-[(2-formylbenzoyl)-methylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[(2-formylbenzoyl)-methylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 144738571 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | tert-butyl (3S)-3-[(2-formylbenzoyl)-methylamino]pyrrolidine-1-carboxylate |
| SMILES | CN(C(=O)c1ccccc1C=O)[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H24N2O4/c1-18(2,3)24-17(23)20-10-9-14(11-20)19(4)16(22)15-8-6-5-7-13(15)12-21/h5-8,12,14H,9-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | DMAIVDSPBXMHOK-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|