C17H24N2O3 — CID 71862110
tert-butyl N-(1-benzoylpyrrolidin-3-yl)-N-methylcarbamate (PubChem CID 71862110) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is tert-butyl N-(1-benzoylpyrrolidin-3-yl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(1-benzoylpyrrolidin-3-yl)-N-methylcarbamate |
|---|---|
| PubChem CID | 71862110 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | tert-butyl N-(1-benzoylpyrrolidin-3-yl)-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)22-16(21)18(4)14-10-11-19(12-14)15(20)13-8-6-5-7-9-13/h5-9,14H,10-12H2,1-4H3 |
| InChIKey | DWYOEESSCODORO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |