C23H34BFN2O5 — CID 176731508
tert-butyl N-[(3R)-1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]-N-methylcarbamate (PubChem CID 176731508) has the molecular formula C23H34BFN2O5 and a molecular weight of 448.34 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3R)-1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 176731508 |
| Molecular Formula | C23H34BFN2O5 |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | tert-butyl N-[(3R)-1-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]pyrrolidin-3-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@@H]1CCN(C(=O)c2ccc(F)c(B3OC(C)(C)C(C)(C)O3)c2)C1 |
| InChI | InChI=1S/C23H34BFN2O5/c1-21(2,3)30-20(29)26(8)16-11-12-27(14-16)19(28)15-9-10-18(25)17(13-15)24-31-22(4,5)23(6,7)32-24/h9-10,13,16H,11-12,14H2,1-8H3/t16-/m1/s1 |
| InChIKey | YLHCPGKEUNUIFU-MRXNPFEDSA-N |
| XLogP | 3.21 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|