C24H37BN2O5 — CID 176731385
tert-butyl (3R)-3-[methyl-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate (PubChem CID 176731385) has the molecular formula C24H37BN2O5 and a molecular weight of 444.38 g/mol. Its IUPAC name is tert-butyl (3R)-3-[methyl-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[methyl-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 176731385 |
| Molecular Formula | C24H37BN2O5 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | tert-butyl (3R)-3-[methyl-[4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoyl]amino]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(C(=O)N(C)[C@@H]2CCN(C(=O)OC(C)(C)C)C2)cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C24H37BN2O5/c1-16-10-11-17(14-19(16)25-31-23(5,6)24(7,8)32-25)20(28)26(9)18-12-13-27(15-18)21(29)30-22(2,3)4/h10-11,14,18H,12-13,15H2,1-9H3/t18-/m1/s1 |
| InChIKey | JBBWYLVPNCPCHV-GOSISDBHSA-N |
| XLogP | 3.38 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|