C11H20N2O4 — CID 77225686
methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 77225686) has the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. Its IUPAC name is methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 77225686 |
| Molecular Formula | C11H20N2O4 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | methyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | CN(C(=O)O)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(16)13-6-5-8(7-13)12(4)9(14)15/h8H,5-7H2,1-4H3,(H,14,15) |
| InChIKey | ZKXQEGLQLIPDSY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |