C19H17F3N6 — CID 142467978
N'-[amino(pyridin-2-yl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide (PubChem CID 142467978) has the molecular formula C19H17F3N6 and a molecular weight of 386.38 g/mol. Its IUPAC name is N'-[amino(pyridin-2-yl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide.
| Compound Name | N'-[amino(pyridin-2-yl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142467978 |
| Molecular Formula | C19H17F3N6 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N'-[amino(pyridin-2-yl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
| SMILES | N/C(=N\N(N)c1ccccn1)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N6/c20-19(21,22)13-8-10-14(11-9-13)26-16-6-2-1-5-15(16)18(23)27-28(24)17-7-3-4-12-25-17/h1-12,26H,24H2,(H2,23,27) |
| InChIKey | BMNUMZJHUICNDR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|