C20H19F3N6O — CID 142468367
N'-[amino(pyridin-2-ylmethyl)amino]-2-[4-(trifluoromethoxy)anilino]benzenecarboximidamide (PubChem CID 142468367) has the molecular formula C20H19F3N6O and a molecular weight of 416.41 g/mol. Its IUPAC name is N'-[amino(pyridin-2-ylmethyl)amino]-2-[4-(trifluoromethoxy)anilino]benzenecarboximidamide.
| Compound Name | N'-[amino(pyridin-2-ylmethyl)amino]-2-[4-(trifluoromethoxy)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142468367 |
| Molecular Formula | C20H19F3N6O |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | N'-[amino(pyridin-2-ylmethyl)amino]-2-[4-(trifluoromethoxy)anilino]benzenecarboximidamide |
| SMILES | N/C(=N\N(N)Cc1ccccn1)c1ccccc1Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H19F3N6O/c21-20(22,23)30-16-10-8-14(9-11-16)27-18-7-2-1-6-17(18)19(24)28-29(25)13-15-5-3-4-12-26-15/h1-12,27H,13,25H2,(H2,24,28) |
| InChIKey | CNYYORXJTTXTAZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|