C16H17F3N6O2 — CID 142468084
2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide (PubChem CID 142468084) has the molecular formula C16H17F3N6O2 and a molecular weight of 382.35 g/mol. Its IUPAC name is 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide.
| Compound Name | 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 142468084 |
| Molecular Formula | C16H17F3N6O2 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide |
| SMILES | N/C(=N\N(N)CC(=O)NO)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3N6O2/c17-16(18,19)10-5-7-11(8-6-10)22-13-4-2-1-3-12(13)15(20)23-25(21)9-14(26)24-27/h1-8,22,27H,9,21H2,(H2,20,23)(H,24,26) |
| InChIKey | YJPMLFWLLHRZSA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|