C17H17F6N5O — CID 142468180
N'-[amino-[2-(trifluoromethoxy)ethyl]amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide (PubChem CID 142468180) has the molecular formula C17H17F6N5O and a molecular weight of 421.35 g/mol. Its IUPAC name is N'-[amino-[2-(trifluoromethoxy)ethyl]amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide.
| Compound Name | N'-[amino-[2-(trifluoromethoxy)ethyl]amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142468180 |
| Molecular Formula | C17H17F6N5O |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N'-[amino-[2-(trifluoromethoxy)ethyl]amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
| SMILES | N/C(=N\N(N)CCOC(F)(F)F)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H17F6N5O/c18-16(19,20)11-5-7-12(8-6-11)26-14-4-2-1-3-13(14)15(24)27-28(25)9-10-29-17(21,22)23/h1-8,26H,9-10,25H2,(H2,24,27) |
| InChIKey | GUQBWTMXNFJLJJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|