C17H13F6N5O — CID 146402505
2-[2-[2-(trifluoromethoxy)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 146402505) has the molecular formula C17H13F6N5O and a molecular weight of 417.31 g/mol. Its IUPAC name is 2-[2-[2-(trifluoromethoxy)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2-[2-[2-(trifluoromethoxy)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 146402505 |
| Molecular Formula | C17H13F6N5O |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-[2-[2-(trifluoromethoxy)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | FC(F)(F)OCCn1nnc(-c2ccccc2Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H13F6N5O/c18-16(19,20)11-5-7-12(8-6-11)24-14-4-2-1-3-13(14)15-25-27-28(26-15)9-10-29-17(21,22)23/h1-8,24H,9-10H2 |
| InChIKey | XSQZZDMWYUVGCJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |