C21H24F3N7O — CID 135372245
1-tert-butyl-3-[2-[5-[2-[4-(trifluoromethyl)anilino]phenyl]tetrazol-2-yl]ethyl]urea (PubChem CID 135372245) has the molecular formula C21H24F3N7O and a molecular weight of 447.47 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[5-[2-[4-(trifluoromethyl)anilino]phenyl]tetrazol-2-yl]ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-[5-[2-[4-(trifluoromethyl)anilino]phenyl]tetrazol-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 135372245 |
| Molecular Formula | C21H24F3N7O |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-tert-butyl-3-[2-[5-[2-[4-(trifluoromethyl)anilino]phenyl]tetrazol-2-yl]ethyl]urea |
| SMILES | CC(C)(C)NC(=O)NCCn1nnc(-c2ccccc2Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C21H24F3N7O/c1-20(2,3)27-19(32)25-12-13-31-29-18(28-30-31)16-6-4-5-7-17(16)26-15-10-8-14(9-11-15)21(22,23)24/h4-11,26H,12-13H2,1-3H3,(H2,25,27,32) |
| InChIKey | BYWXPXUTXXCUDV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |