C17H17F3N6 — CID 135372658
2-[2-[2-(methylamino)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 135372658) has the molecular formula C17H17F3N6 and a molecular weight of 362.36 g/mol. Its IUPAC name is 2-[2-[2-(methylamino)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2-[2-[2-(methylamino)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 135372658 |
| Molecular Formula | C17H17F3N6 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[2-[2-(methylamino)ethyl]tetrazol-5-yl]-N-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | CNCCn1nnc(-c2ccccc2Nc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H17F3N6/c1-21-10-11-26-24-16(23-25-26)14-4-2-3-5-15(14)22-13-8-6-12(7-9-13)17(18,19)20/h2-9,21-22H,10-11H2,1H3 |
| InChIKey | FSSYBQMNPNFAFQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |