C18H12F3N7 — CID 146402504
2-(2-pyrimidin-4-yltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 146402504) has the molecular formula C18H12F3N7 and a molecular weight of 383.34 g/mol. Its IUPAC name is 2-(2-pyrimidin-4-yltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]aniline.
| Compound Name | 2-(2-pyrimidin-4-yltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 146402504 |
| Molecular Formula | C18H12F3N7 |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-(2-pyrimidin-4-yltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | FC(F)(F)c1ccc(Nc2ccccc2-c2nnn(-c3ccncn3)n2)cc1 |
| InChI | InChI=1S/C18H12F3N7/c19-18(20,21)12-5-7-13(8-6-12)24-15-4-2-1-3-14(15)17-25-27-28(26-17)16-9-10-22-11-23-16/h1-11,24H |
| InChIKey | WMYXNDWDJHXJNQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |