C24H19F3N4 — CID 11350663
6-[2-(4-methylanilino)phenyl]-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine (PubChem CID 11350663) has the molecular formula C24H19F3N4 and a molecular weight of 420.44 g/mol. Its IUPAC name is 6-[2-(4-methylanilino)phenyl]-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-[2-(4-methylanilino)phenyl]-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 11350663 |
| Molecular Formula | C24H19F3N4 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 6-[2-(4-methylanilino)phenyl]-N-[4-(trifluoromethyl)phenyl]pyrimidin-4-amine |
| SMILES | Cc1ccc(Nc2ccccc2-c2cc(Nc3ccc(C(F)(F)F)cc3)ncn2)cc1 |
| InChI | InChI=1S/C24H19F3N4/c1-16-6-10-18(11-7-16)30-21-5-3-2-4-20(21)22-14-23(29-15-28-22)31-19-12-8-17(9-13-19)24(25,26)27/h2-15,30H,1H3,(H,28,29,31) |
| InChIKey | ATSILQWGMQQEGV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |