C17H17F2N5O — CID 162609941
2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol (PubChem CID 162609941) has the molecular formula C17H17F2N5O and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol.
| Compound Name | 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol |
|---|---|
| PubChem CID | 162609941 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol |
| SMILES | CC(F)(F)c1ccc(Nc2ccccc2-c2nnn(CCO)n2)cc1 |
| InChI | InChI=1S/C17H17F2N5O/c1-17(18,19)12-6-8-13(9-7-12)20-15-5-3-2-4-14(15)16-21-23-24(22-16)10-11-25/h2-9,20,25H,10-11H2,1H3 |
| InChIKey | KEHKLJIQUBKGGM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |