About 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol
2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol (PubChem CID 162609941) has the molecular formula C17H17F2N5O
and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol |
| PubChem CID | 162609941 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol |
| SMILES | CC(F)(F)c1ccc(Nc2ccccc2-c2nnn(CCO)n2)cc1 |
| InChI | InChI=1S/C17H17F2N5O/c1-17(18,19)12-6-8-13(9-7-12)20-15-5-3-2-4-14(15)16-21-23-24(22-16)10-11-25/h2-9,20,25H,10-11H2,1H3 |
| InChIKey | KEHKLJIQUBKGGM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol?
The IUPAC name of 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol (CID 162609941) is 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol.
What is the SMILES notation for 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol?
The canonical SMILES for 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol is CC(F)(F)c1ccc(Nc2ccccc2-c2nnn(CCO)n2)cc1.
What is the InChIKey of 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol?
The InChIKey is KEHKLJIQUBKGGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N5O/c1-17(18,19)12-6-8-13(9-7-12)20-15-5-3-2-4-14(15)16-21-23-24(22-16)10-11-25/h2-9,20,25H,10-11H2,1H3.
What are the key properties of 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol?
2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol has a molecular weight of 345.35 g/mol, XLogP of 3.19, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-[4-(1,1-difluoroethyl)anilino]phenyl]tetrazol-2-yl]ethanol is sourced from PubChem (CID 162609941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).