C19H21F3N6O — CID 142468197
2-[2-[3-(dimethylamino)propyl]tetrazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 142468197) has the molecular formula C19H21F3N6O and a molecular weight of 406.41 g/mol. Its IUPAC name is 2-[2-[3-(dimethylamino)propyl]tetrazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | 2-[2-[3-(dimethylamino)propyl]tetrazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 142468197 |
| Molecular Formula | C19H21F3N6O |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[2-[3-(dimethylamino)propyl]tetrazol-5-yl]-N-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | CN(C)CCCn1nnc(-c2ccccc2Nc2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C19H21F3N6O/c1-27(2)12-5-13-28-25-18(24-26-28)16-6-3-4-7-17(16)23-14-8-10-15(11-9-14)29-19(20,21)22/h3-4,6-11,23H,5,12-13H2,1-2H3 |
| InChIKey | NIRNKWQMCMJGEY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |