C16H16F3N5O — CID 142468341
ethane;2-(2H-tetrazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 142468341) has the molecular formula C16H16F3N5O and a molecular weight of 351.33 g/mol. Its IUPAC name is ethane;2-(2H-tetrazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | ethane;2-(2H-tetrazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 142468341 |
| Molecular Formula | C16H16F3N5O |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | ethane;2-(2H-tetrazol-5-yl)-N-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | CC.FC(F)(F)Oc1ccc(Nc2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C14H10F3N5O.C2H6/c15-14(16,17)23-10-7-5-9(6-8-10)18-12-4-2-1-3-11(12)13-19-21-22-20-13;1-2/h1-8,18H,(H,19,20,21,22);1-2H3 |
| InChIKey | QZPNNFTZKSGJFY-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |