C20H25N5O — CID 142468317
N'-[amino-(2-cyclopropyl-2-oxoethyl)amino]-2-(4-ethylanilino)benzenecarboximidamide (PubChem CID 142468317) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is N'-[amino-(2-cyclopropyl-2-oxoethyl)amino]-2-(4-ethylanilino)benzenecarboximidamide.
| Compound Name | N'-[amino-(2-cyclopropyl-2-oxoethyl)amino]-2-(4-ethylanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 142468317 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | N'-[amino-(2-cyclopropyl-2-oxoethyl)amino]-2-(4-ethylanilino)benzenecarboximidamide |
| SMILES | CCc1ccc(Nc2ccccc2/C(N)=N/N(N)CC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-2-14-7-11-16(12-8-14)23-18-6-4-3-5-17(18)20(21)24-25(22)13-19(26)15-9-10-15/h3-8,11-12,15,23H,2,9-10,13,22H2,1H3,(H2,21,24) |
| InChIKey | CHFCPSSFWRYPHV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|