C28H25F3N4O2 — CID 42642090
2-[bis(pyridin-2-ylmethyl)amino]ethyl 2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 42642090) has the molecular formula C28H25F3N4O2 and a molecular weight of 506.53 g/mol. Its IUPAC name is 2-[bis(pyridin-2-ylmethyl)amino]ethyl 2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | 2-[bis(pyridin-2-ylmethyl)amino]ethyl 2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 42642090 |
| Molecular Formula | C28H25F3N4O2 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 2-[bis(pyridin-2-ylmethyl)amino]ethyl 2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | O=C(OCCN(Cc1ccccn1)Cc1ccccn1)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H25F3N4O2/c29-28(30,31)21-8-7-11-22(18-21)34-26-13-2-1-12-25(26)27(36)37-17-16-35(19-23-9-3-5-14-32-23)20-24-10-4-6-15-33-24/h1-15,18,34H,16-17,19-20H2 |
| InChIKey | POUUOCHFNVRWDJ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |