C17H17F3N2O2 — CID 100647977
propyl 5-amino-2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 100647977) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is propyl 5-amino-2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | propyl 5-amino-2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 100647977 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | propyl 5-amino-2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | CCCOC(=O)c1cc(N)ccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N2O2/c1-2-8-24-16(23)14-10-12(21)6-7-15(14)22-13-5-3-4-11(9-13)17(18,19)20/h3-7,9-10,22H,2,8,21H2,1H3 |
| InChIKey | ASADJGHDVZDVKQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|