C16H17F3N2O — CID 142468111
ethane;2-[3-(trifluoromethyl)anilino]benzamide (PubChem CID 142468111) has the molecular formula C16H17F3N2O and a molecular weight of 310.32 g/mol. Its IUPAC name is ethane;2-[3-(trifluoromethyl)anilino]benzamide.
| Compound Name | ethane;2-[3-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 142468111 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | ethane;2-[3-(trifluoromethyl)anilino]benzamide |
| SMILES | CC.NC(=O)c1ccccc1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F3N2O.C2H6/c15-14(16,17)9-4-3-5-10(8-9)19-12-7-2-1-6-11(12)13(18)20;1-2/h1-8,19H,(H2,18,20);1-2H3 |
| InChIKey | JGONXDMHMUMWEJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |