C20H30F3NO3 — CID 166100670
tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;propane (PubChem CID 166100670) has the molecular formula C20H30F3NO3 and a molecular weight of 389.46 g/mol. Its IUPAC name is tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;propane.
| Compound Name | tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;propane |
|---|---|
| PubChem CID | 166100670 |
| Molecular Formula | C20H30F3NO3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;propane |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCc2ccc(C(F)(F)F)cc2)C1.CCC |
| InChI | InChI=1S/C17H22F3NO3.C3H8/c1-16(2,3)24-15(22)21-9-8-14(10-21)23-11-12-4-6-13(7-5-12)17(18,19)20;1-3-2/h4-7,14H,8-11H2,1-3H3;3H2,1-2H3 |
| InChIKey | JSOXNDJLLZYYEX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |