C26H35F3N4O4S — CID 166100704
tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;(Z)-2-hydrazinyl-1-(3-methylsulfinylphenyl)ethenamine (PubChem CID 166100704) has the molecular formula C26H35F3N4O4S and a molecular weight of 556.65 g/mol. Its IUPAC name is tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;(Z)-2-hydrazinyl-1-(3-methylsulfinylphenyl)ethenamine.
| Compound Name | tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;(Z)-2-hydrazinyl-1-(3-methylsulfinylphenyl)ethenamine |
|---|---|
| PubChem CID | 166100704 |
| Molecular Formula | C26H35F3N4O4S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | tert-butyl 3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidine-1-carboxylate;(Z)-2-hydrazinyl-1-(3-methylsulfinylphenyl)ethenamine |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCc2ccc(C(F)(F)F)cc2)C1.CS(=O)c1cccc(/C(N)=C/NN)c1 |
| InChI | InChI=1S/C17H22F3NO3.C9H13N3OS/c1-16(2,3)24-15(22)21-9-8-14(10-21)23-11-12-4-6-13(7-5-12)17(18,19)20;1-14(13)8-4-2-3-7(5-8)9(10)6-12-11/h4-7,14H,8-11H2,1-3H3;2-6,12H,10-11H2,1H3/b;9-6- |
| InChIKey | WTICVTBIVBVULS-UGCXORAOSA-N |
| XLogP | 4.38 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|