C19H30F3NO2 — CID 166100781
ethane;1-[3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]propan-1-one (PubChem CID 166100781) has the molecular formula C19H30F3NO2 and a molecular weight of 361.45 g/mol. Its IUPAC name is ethane;1-[3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]propan-1-one.
| Compound Name | ethane;1-[3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 166100781 |
| Molecular Formula | C19H30F3NO2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | ethane;1-[3-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]propan-1-one |
| SMILES | CC.CC.CCC(=O)N1CCC(OCc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H18F3NO2.2C2H6/c1-2-14(20)19-8-7-13(9-19)21-10-11-3-5-12(6-4-11)15(16,17)18;2*1-2/h3-6,13H,2,7-10H2,1H3;2*1-2H3 |
| InChIKey | ULBHHYJILKVCFS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |