C19H24F3N3O3 — CID 155713070
ethane;formamide;N-(1-hydroxyethyl)-2-[4-(trifluoromethyl)anilino]benzamide (PubChem CID 155713070) has the molecular formula C19H24F3N3O3 and a molecular weight of 399.41 g/mol. Its IUPAC name is ethane;formamide;N-(1-hydroxyethyl)-2-[4-(trifluoromethyl)anilino]benzamide.
| Compound Name | ethane;formamide;N-(1-hydroxyethyl)-2-[4-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 155713070 |
| Molecular Formula | C19H24F3N3O3 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethane;formamide;N-(1-hydroxyethyl)-2-[4-(trifluoromethyl)anilino]benzamide |
| SMILES | CC.CC(O)NC(=O)c1ccccc1Nc1ccc(C(F)(F)F)cc1.NC=O |
| InChI | InChI=1S/C16H15F3N2O2.C2H6.CH3NO/c1-10(22)20-15(23)13-4-2-3-5-14(13)21-12-8-6-11(7-9-12)16(17,18)19;1-2;2-1-3/h2-10,21-22H,1H3,(H,20,23);1-2H3;1H,(H2,2,3) |
| InChIKey | GMTSJEMZLVJUIW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|