C23H23F3N4O2S — CID 155713022
ethane;1-phenylsulfanyl-3-[[2-[4-(trifluoromethyl)anilino]benzoyl]amino]urea (PubChem CID 155713022) has the molecular formula C23H23F3N4O2S and a molecular weight of 476.52 g/mol. Its IUPAC name is ethane;1-phenylsulfanyl-3-[[2-[4-(trifluoromethyl)anilino]benzoyl]amino]urea.
| Compound Name | ethane;1-phenylsulfanyl-3-[[2-[4-(trifluoromethyl)anilino]benzoyl]amino]urea |
|---|---|
| PubChem CID | 155713022 |
| Molecular Formula | C23H23F3N4O2S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | ethane;1-phenylsulfanyl-3-[[2-[4-(trifluoromethyl)anilino]benzoyl]amino]urea |
| SMILES | CC.O=C(NNC(=O)c1ccccc1Nc1ccc(C(F)(F)F)cc1)NSc1ccccc1 |
| InChI | InChI=1S/C21H17F3N4O2S.C2H6/c22-21(23,24)14-10-12-15(13-11-14)25-18-9-5-4-8-17(18)19(29)26-27-20(30)28-31-16-6-2-1-3-7-16;1-2/h1-13,25H,(H,26,29)(H2,27,28,30);1-2H3 |
| InChIKey | VGFMBLJQGGTBJT-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|