C19H17F3N4O2 — CID 155224042
N'-(2-cyano-2-methylpropanoyl)-2-[4-(trifluoromethyl)anilino]benzohydrazide (PubChem CID 155224042) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is N'-(2-cyano-2-methylpropanoyl)-2-[4-(trifluoromethyl)anilino]benzohydrazide.
| Compound Name | N'-(2-cyano-2-methylpropanoyl)-2-[4-(trifluoromethyl)anilino]benzohydrazide |
|---|---|
| PubChem CID | 155224042 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | N'-(2-cyano-2-methylpropanoyl)-2-[4-(trifluoromethyl)anilino]benzohydrazide |
| SMILES | CC(C)(C#N)C(=O)NNC(=O)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N4O2/c1-18(2,11-23)17(28)26-25-16(27)14-5-3-4-6-15(14)24-13-9-7-12(8-10-13)19(20,21)22/h3-10,24H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | FUBHZUBSFMUMQW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|