C20H19F3N4O3 — CID 155223984
3-methyl-2-oxo-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]pyrrolidine-3-carbohydrazide (PubChem CID 155223984) has the molecular formula C20H19F3N4O3 and a molecular weight of 420.39 g/mol. Its IUPAC name is 3-methyl-2-oxo-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]pyrrolidine-3-carbohydrazide.
| Compound Name | 3-methyl-2-oxo-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]pyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 155223984 |
| Molecular Formula | C20H19F3N4O3 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 3-methyl-2-oxo-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]pyrrolidine-3-carbohydrazide |
| SMILES | CC1(C(=O)NNC(=O)c2ccccc2Nc2ccc(C(F)(F)F)cc2)CCNC1=O |
| InChI | InChI=1S/C20H19F3N4O3/c1-19(10-11-24-17(19)29)18(30)27-26-16(28)14-4-2-3-5-15(14)25-13-8-6-12(7-9-13)20(21,22)23/h2-9,25H,10-11H2,1H3,(H,24,29)(H,26,28)(H,27,30) |
| InChIKey | UKPQJCZLNMPAQT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|