C22H26F3N3O3 — CID 155712990
ethane;2-methyl-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]oxolane-2-carbohydrazide (PubChem CID 155712990) has the molecular formula C22H26F3N3O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is ethane;2-methyl-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]oxolane-2-carbohydrazide.
| Compound Name | ethane;2-methyl-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 155712990 |
| Molecular Formula | C22H26F3N3O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | ethane;2-methyl-N'-[2-[4-(trifluoromethyl)anilino]benzoyl]oxolane-2-carbohydrazide |
| SMILES | CC.CC1(C(=O)NNC(=O)c2ccccc2Nc2ccc(C(F)(F)F)cc2)CCCO1 |
| InChI | InChI=1S/C20H20F3N3O3.C2H6/c1-19(11-4-12-29-19)18(28)26-25-17(27)15-5-2-3-6-16(15)24-14-9-7-13(8-10-14)20(21,22)23;1-2/h2-3,5-10,24H,4,11-12H2,1H3,(H,25,27)(H,26,28);1-2H3 |
| InChIKey | SGUIFHFHABZYQC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|