C21H22F3N3O4 — CID 155211832
ethyl 2,2-dimethyl-3-oxo-3-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]propanoate (PubChem CID 155211832) has the molecular formula C21H22F3N3O4 and a molecular weight of 437.42 g/mol. Its IUPAC name is ethyl 2,2-dimethyl-3-oxo-3-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]propanoate.
| Compound Name | ethyl 2,2-dimethyl-3-oxo-3-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]propanoate |
|---|---|
| PubChem CID | 155211832 |
| Molecular Formula | C21H22F3N3O4 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | ethyl 2,2-dimethyl-3-oxo-3-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]propanoate |
| SMILES | CCOC(=O)C(C)(C)C(=O)NNC(=O)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3N3O4/c1-4-31-19(30)20(2,3)18(29)27-26-17(28)15-7-5-6-8-16(15)25-14-11-9-13(10-12-14)21(22,23)24/h5-12,25H,4H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | BOKLXDYYMOYOLW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|