C24H29F3N4O4 — CID 155211826
tert-butyl N-methyl-N-[4-oxo-4-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]butyl]carbamate (PubChem CID 155211826) has the molecular formula C24H29F3N4O4 and a molecular weight of 494.51 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[4-oxo-4-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]butyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[4-oxo-4-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]butyl]carbamate |
|---|---|
| PubChem CID | 155211826 |
| Molecular Formula | C24H29F3N4O4 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | tert-butyl N-methyl-N-[4-oxo-4-[2-[2-[4-(trifluoromethyl)anilino]benzoyl]hydrazinyl]butyl]carbamate |
| SMILES | CN(CCCC(=O)NNC(=O)c1ccccc1Nc1ccc(C(F)(F)F)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H29F3N4O4/c1-23(2,3)35-22(34)31(4)15-7-10-20(32)29-30-21(33)18-8-5-6-9-19(18)28-17-13-11-16(12-14-17)24(25,26)27/h5-6,8-9,11-14,28H,7,10,15H2,1-4H3,(H,29,32)(H,30,33) |
| InChIKey | BPXGOMBNEJTBLI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|