C25H34F3N7O5 — CID 167210588
ethyl N-[2-[2-[2-[[3-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-4-[4-(trifluoromethyl)anilino]benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 167210588) has the molecular formula C25H34F3N7O5 and a molecular weight of 569.59 g/mol. Its IUPAC name is ethyl N-[2-[2-[2-[[3-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-4-[4-(trifluoromethyl)anilino]benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | ethyl N-[2-[2-[2-[[3-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-4-[4-(trifluoromethyl)anilino]benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 167210588 |
| Molecular Formula | C25H34F3N7O5 |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | ethyl N-[2-[2-[2-[[3-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]-4-[4-(trifluoromethyl)anilino]benzoyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCOC(=O)NCCOCCOCCNC(=O)c1ccc(Nc2ccc(C(F)(F)F)cc2)c(/C(N)=N/N(C)N)c1 |
| InChI | InChI=1S/C25H34F3N7O5/c1-3-40-24(37)32-11-13-39-15-14-38-12-10-31-23(36)17-4-9-21(20(16-17)22(29)34-35(2)30)33-19-7-5-18(6-8-19)25(26,27)28/h4-9,16,33H,3,10-15,30H2,1-2H3,(H2,29,34)(H,31,36)(H,32,37) |
| InChIKey | JROZQNXLVRAMHS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|