C17H22F3N5O2 — CID 142468092
N'-[amino(2-hydroxyethyl)amino]-2-[[(3E,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-4-yl]amino]benzenecarboximidamide (PubChem CID 142468092) has the molecular formula C17H22F3N5O2 and a molecular weight of 385.39 g/mol. Its IUPAC name is N'-[amino(2-hydroxyethyl)amino]-2-[[(3E,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-4-yl]amino]benzenecarboximidamide.
| Compound Name | N'-[amino(2-hydroxyethyl)amino]-2-[[(3E,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-4-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142468092 |
| Molecular Formula | C17H22F3N5O2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N'-[amino(2-hydroxyethyl)amino]-2-[[(3E,5E)-5-(trifluoromethoxy)hepta-1,3,5-trien-4-yl]amino]benzenecarboximidamide |
| SMILES | C=C/C=C(Nc1ccccc1/C(N)=N/N(N)CCO)\C(=C/C)OC(F)(F)F |
| InChI | InChI=1S/C17H22F3N5O2/c1-3-7-14(15(4-2)27-17(18,19)20)23-13-9-6-5-8-12(13)16(21)24-25(22)10-11-26/h3-9,23,26H,1,10-11,22H2,2H3,(H2,21,24)/b14-7+,15-4+ |
| InChIKey | HIOTXAQLYFGGOA-ATVLPQEZSA-N |
| XLogP | 2.40 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|