C15H10F2N2 — CID 82536785
N-(2,5-difluorophenyl)quinolin-2-amine (PubChem CID 82536785) has the molecular formula C15H10F2N2 and a molecular weight of 256.25 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)quinolin-2-amine.
| Compound Name | N-(2,5-difluorophenyl)quinolin-2-amine |
|---|---|
| PubChem CID | 82536785 |
| Molecular Formula | C15H10F2N2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(2,5-difluorophenyl)quinolin-2-amine |
| SMILES | Fc1ccc(F)c(Nc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C15H10F2N2/c16-11-6-7-12(17)14(9-11)19-15-8-5-10-3-1-2-4-13(10)18-15/h1-9H,(H,18,19) |
| InChIKey | WCQSIILNYDRQGT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |