C15H9F3N2 — CID 2320272
N-(2,3,4-trifluorophenyl)quinolin-2-amine (PubChem CID 2320272) has the molecular formula C15H9F3N2 and a molecular weight of 274.25 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)quinolin-2-amine.
| Compound Name | N-(2,3,4-trifluorophenyl)quinolin-2-amine |
|---|---|
| PubChem CID | 2320272 |
| Molecular Formula | C15H9F3N2 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)quinolin-2-amine |
| SMILES | Fc1ccc(Nc2ccc3ccccc3n2)c(F)c1F |
| InChI | InChI=1S/C15H9F3N2/c16-10-6-7-12(15(18)14(10)17)20-13-8-5-9-3-1-2-4-11(9)19-13/h1-8H,(H,19,20) |
| InChIKey | KQRUOFSGEWQVON-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|