C18H15F3N2O — CID 146295747
N-[2-ethyl-4-(trifluoromethoxy)phenyl]quinolin-2-amine (PubChem CID 146295747) has the molecular formula C18H15F3N2O and a molecular weight of 332.33 g/mol. Its IUPAC name is N-[2-ethyl-4-(trifluoromethoxy)phenyl]quinolin-2-amine.
| Compound Name | N-[2-ethyl-4-(trifluoromethoxy)phenyl]quinolin-2-amine |
|---|---|
| PubChem CID | 146295747 |
| Molecular Formula | C18H15F3N2O |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-[2-ethyl-4-(trifluoromethoxy)phenyl]quinolin-2-amine |
| SMILES | CCc1cc(OC(F)(F)F)ccc1Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C18H15F3N2O/c1-2-12-11-14(24-18(19,20)21)8-9-16(12)23-17-10-7-13-5-3-4-6-15(13)22-17/h3-11H,2H2,1H3,(H,22,23) |
| InChIKey | QJWSREUQGRCBMB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |