C16H10ClF3N2O4P+ — CID 118665746
[2-[(8-chloroquinolin-2-yl)amino]-5-(trifluoromethoxy)phenoxy]-hydroxy-oxophosphanium (PubChem CID 118665746) has the molecular formula C16H10ClF3N2O4P+ and a molecular weight of 417.69 g/mol. Its IUPAC name is [2-[(8-chloroquinolin-2-yl)amino]-5-(trifluoromethoxy)phenoxy]-hydroxy-oxophosphanium.
| Compound Name | [2-[(8-chloroquinolin-2-yl)amino]-5-(trifluoromethoxy)phenoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 118665746 |
| Molecular Formula | C16H10ClF3N2O4P+ |
| Molecular Weight | 417.69 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | [2-[(8-chloroquinolin-2-yl)amino]-5-(trifluoromethoxy)phenoxy]-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)Oc1cc(OC(F)(F)F)ccc1Nc1ccc2cccc(Cl)c2n1 |
| InChI | InChI=1S/C16H9ClF3N2O4P/c17-11-3-1-2-9-4-7-14(22-15(9)11)21-12-6-5-10(25-16(18,19)20)8-13(12)26-27(23)24/h1-8H,(H-,21,22,23,24)/p+1 |
| InChIKey | GAXCUZUXJZELHO-UHFFFAOYSA-O |
| XLogP | 5.56 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|