C12H7ClF3N — CID 82536911
N-(4-chlorophenyl)-2,3,4-trifluoroaniline (PubChem CID 82536911) has the molecular formula C12H7ClF3N and a molecular weight of 257.64 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,3,4-trifluoroaniline.
| Compound Name | N-(4-chlorophenyl)-2,3,4-trifluoroaniline |
|---|---|
| PubChem CID | 82536911 |
| Molecular Formula | C12H7ClF3N |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | N-(4-chlorophenyl)-2,3,4-trifluoroaniline |
| SMILES | Fc1ccc(Nc2ccc(Cl)cc2)c(F)c1F |
| InChI | InChI=1S/C12H7ClF3N/c13-7-1-3-8(4-2-7)17-10-6-5-9(14)11(15)12(10)16/h1-6,17H |
| InChIKey | WVYGDVXCBZJYJP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|