C16H15F3N2O — CID 112990145
2-methyl-N-[4-(2,3,4-trifluoroanilino)phenyl]propanamide (PubChem CID 112990145) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 2-methyl-N-[4-(2,3,4-trifluoroanilino)phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-(2,3,4-trifluoroanilino)phenyl]propanamide |
|---|---|
| PubChem CID | 112990145 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-methyl-N-[4-(2,3,4-trifluoroanilino)phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H15F3N2O/c1-9(2)16(22)21-11-5-3-10(4-6-11)20-13-8-7-12(17)14(18)15(13)19/h3-9,20H,1-2H3,(H,21,22) |
| InChIKey | FHTDQWXMMHIORL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|