C17H13F2N5O2 — CID 19153865
4-[[5-amino-6-(2,5-difluoroanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 19153865) has the molecular formula C17H13F2N5O2 and a molecular weight of 357.32 g/mol. Its IUPAC name is 4-[[5-amino-6-(2,5-difluoroanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5-amino-6-(2,5-difluoroanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 19153865 |
| Molecular Formula | C17H13F2N5O2 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-[[5-amino-6-(2,5-difluoroanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Nc1c(Nc2ccc(C(=O)O)cc2)ncnc1Nc1cc(F)ccc1F |
| InChI | InChI=1S/C17H13F2N5O2/c18-10-3-6-12(19)13(7-10)24-16-14(20)15(21-8-22-16)23-11-4-1-9(2-5-11)17(25)26/h1-8H,20H2,(H,25,26)(H2,21,22,23,24) |
| InChIKey | NDZYVQKISXBTQB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |