C18H13ClF3N5O2 — CID 22541316
4-[[5-amino-6-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 22541316) has the molecular formula C18H13ClF3N5O2 and a molecular weight of 423.78 g/mol. Its IUPAC name is 4-[[5-amino-6-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5-amino-6-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22541316 |
| Molecular Formula | C18H13ClF3N5O2 |
| Molecular Weight | 423.78 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 4-[[5-amino-6-[2-chloro-5-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | Nc1c(Nc2ccc(C(=O)O)cc2)ncnc1Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H13ClF3N5O2/c19-12-6-3-10(18(20,21)22)7-13(12)27-16-14(23)15(24-8-25-16)26-11-4-1-9(2-5-11)17(28)29/h1-8H,23H2,(H,28,29)(H2,24,25,26,27) |
| InChIKey | YUEOBLXWBOXTAC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.78 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |