C13H11F2N3O — CID 61306978
2-amino-5-(2,3-difluoroanilino)benzamide (PubChem CID 61306978) has the molecular formula C13H11F2N3O and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-amino-5-(2,3-difluoroanilino)benzamide.
| Compound Name | 2-amino-5-(2,3-difluoroanilino)benzamide |
|---|---|
| PubChem CID | 61306978 |
| Molecular Formula | C13H11F2N3O |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-amino-5-(2,3-difluoroanilino)benzamide |
| SMILES | NC(=O)c1cc(Nc2cccc(F)c2F)ccc1N |
| InChI | InChI=1S/C13H11F2N3O/c14-9-2-1-3-11(12(9)15)18-7-4-5-10(16)8(6-7)13(17)19/h1-6,18H,16H2,(H2,17,19) |
| InChIKey | RBPUYICNCIQCMC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|