C15H13N3O3 — CID 62354736
N-(5-cyano-2-pyridinyl)-2,6-dimethoxybenzamide (PubChem CID 62354736) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-2,6-dimethoxybenzamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 62354736 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(C#N)cn1 |
| InChI | InChI=1S/C15H13N3O3/c1-20-11-4-3-5-12(21-2)14(11)15(19)18-13-7-6-10(8-16)9-17-13/h3-7,9H,1-2H3,(H,17,18,19) |
| InChIKey | JUQWSXHLHGEILN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |