C18H19N5O4 — CID 87434462
[[N-(5-cyano-2-pyridinyl)-N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino] acetate (PubChem CID 87434462) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is [[N-(5-cyano-2-pyridinyl)-N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino] acetate.
| Compound Name | [[N-(5-cyano-2-pyridinyl)-N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino] acetate |
|---|---|
| PubChem CID | 87434462 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [[N-(5-cyano-2-pyridinyl)-N'-[(2,6-dimethoxyphenyl)methyl]carbamimidoyl]amino] acetate |
| SMILES | COc1cccc(OC)c1C/N=C(\NOC(C)=O)Nc1ccc(C#N)cn1 |
| InChI | InChI=1S/C18H19N5O4/c1-12(24)27-23-18(22-17-8-7-13(9-19)10-20-17)21-11-14-15(25-2)5-4-6-16(14)26-3/h4-8,10H,11H2,1-3H3,(H2,20,21,22,23) |
| InChIKey | LBIUFNYPTZWKJZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|