C22H21FN4O3 — CID 118971151
[[N-[4-(4-fluorophenyl)-2-pyridinyl]-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino] acetate (PubChem CID 118971151) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is [[N-[4-(4-fluorophenyl)-2-pyridinyl]-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino] acetate.
| Compound Name | [[N-[4-(4-fluorophenyl)-2-pyridinyl]-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino] acetate |
|---|---|
| PubChem CID | 118971151 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [[N-[4-(4-fluorophenyl)-2-pyridinyl]-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino] acetate |
| SMILES | COc1ccccc1C/N=C(\NOC(C)=O)Nc1cc(-c2ccc(F)cc2)ccn1 |
| InChI | InChI=1S/C22H21FN4O3/c1-15(28)30-27-22(25-14-18-5-3-4-6-20(18)29-2)26-21-13-17(11-12-24-21)16-7-9-19(23)10-8-16/h3-13H,14H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | ZYZYOFRBYZZATL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|