C14H19N5O3 — CID 67387494
acetic acid;1-(1H-imidazol-2-yl)-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 67387494) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is acetic acid;1-(1H-imidazol-2-yl)-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | acetic acid;1-(1H-imidazol-2-yl)-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 67387494 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | acetic acid;1-(1H-imidazol-2-yl)-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | CC(=O)O.COc1ccccc1C/N=C(\N)Nc1ncc[nH]1 |
| InChI | InChI=1S/C12H15N5O.C2H4O2/c1-18-10-5-3-2-4-9(10)8-16-11(13)17-12-14-6-7-15-12;1-2(3)4/h2-7H,8H2,1H3,(H4,13,14,15,16,17);1H3,(H,3,4) |
| InChIKey | FOTHRNPTFNPRRG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|