C21H22N4O — CID 67532961
1-(6-benzyl-2-pyridinyl)-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 67532961) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-(6-benzyl-2-pyridinyl)-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-(6-benzyl-2-pyridinyl)-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 67532961 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-(6-benzyl-2-pyridinyl)-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | COc1ccccc1C/N=C(\N)Nc1cccc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H22N4O/c1-26-19-12-6-5-10-17(19)15-23-21(22)25-20-13-7-11-18(24-20)14-16-8-3-2-4-9-16/h2-13H,14-15H2,1H3,(H3,22,23,24,25) |
| InChIKey | FXLSCXHHPAPKGT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|