C21H17N3O3 — CID 90237587
N-(5-cyano-2-pyridinyl)-3-[(4-methoxyphenyl)methoxy]benzamide (PubChem CID 90237587) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-(5-cyano-2-pyridinyl)-3-[(4-methoxyphenyl)methoxy]benzamide.
| Compound Name | N-(5-cyano-2-pyridinyl)-3-[(4-methoxyphenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 90237587 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(5-cyano-2-pyridinyl)-3-[(4-methoxyphenyl)methoxy]benzamide |
| SMILES | COc1ccc(COc2cccc(C(=O)Nc3ccc(C#N)cn3)c2)cc1 |
| InChI | InChI=1S/C21H17N3O3/c1-26-18-8-5-15(6-9-18)14-27-19-4-2-3-17(11-19)21(25)24-20-10-7-16(12-22)13-23-20/h2-11,13H,14H2,1H3,(H,23,24,25) |
| InChIKey | YMCPEYBRDGWIEL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |