C36H27NO5 — CID 10325338
4-[[2,4-dibenzoyl-5-[(4-methoxyphenyl)methoxy]phenoxy]methyl]benzonitrile (PubChem CID 10325338) has the molecular formula C36H27NO5 and a molecular weight of 553.61 g/mol. Its IUPAC name is 4-[[2,4-dibenzoyl-5-[(4-methoxyphenyl)methoxy]phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[2,4-dibenzoyl-5-[(4-methoxyphenyl)methoxy]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 10325338 |
| Molecular Formula | C36H27NO5 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | 4-[[2,4-dibenzoyl-5-[(4-methoxyphenyl)methoxy]phenoxy]methyl]benzonitrile |
| SMILES | COc1ccc(COc2cc(OCc3ccc(C#N)cc3)c(C(=O)c3ccccc3)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H27NO5/c1-40-30-18-16-27(17-19-30)24-42-34-21-33(41-23-26-14-12-25(22-37)13-15-26)31(35(38)28-8-4-2-5-9-28)20-32(34)36(39)29-10-6-3-7-11-29/h2-21H,23-24H2,1H3 |
| InChIKey | IQQUDNQISYNNOB-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |