C20H27N3O3 — CID 113030910
N-[5-(dipropylamino)-2-pyridinyl]-2,6-dimethoxybenzamide (PubChem CID 113030910) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[5-(dipropylamino)-2-pyridinyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[5-(dipropylamino)-2-pyridinyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 113030910 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[5-(dipropylamino)-2-pyridinyl]-2,6-dimethoxybenzamide |
| SMILES | CCCN(CCC)c1ccc(NC(=O)c2c(OC)cccc2OC)nc1 |
| InChI | InChI=1S/C20H27N3O3/c1-5-12-23(13-6-2)15-10-11-18(21-14-15)22-20(24)19-16(25-3)8-7-9-17(19)26-4/h7-11,14H,5-6,12-13H2,1-4H3,(H,21,22,24) |
| InChIKey | NZEIQAZDKSDLOJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |